C9H14IN3 — CID 66299498
6-ethyl-5-iodo-N-propylpyrimidin-4-amine (PubChem CID 66299498) has the molecular formula C9H14IN3 and a molecular weight of 291.14 g/mol. Its IUPAC name is 6-ethyl-5-iodo-N-propylpyrimidin-4-amine.
| Compound Name | 6-ethyl-5-iodo-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 66299498 |
| Molecular Formula | C9H14IN3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 6-ethyl-5-iodo-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1ncnc(CC)c1I |
| InChI | InChI=1S/C9H14IN3/c1-3-5-11-9-8(10)7(4-2)12-6-13-9/h6H,3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | IYWLCWDNLKXOOJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|