C13H18N4S — CID 79819683
5-ethyl-N-propyl-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine (PubChem CID 79819683) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 5-ethyl-N-propyl-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 5-ethyl-N-propyl-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79819683 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-ethyl-N-propyl-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCCNc1ncnc(Cc2nccs2)c1CC |
| InChI | InChI=1S/C13H18N4S/c1-3-5-15-13-10(4-2)11(16-9-17-13)8-12-14-6-7-18-12/h6-7,9H,3-5,8H2,1-2H3,(H,15,16,17) |
| InChIKey | RVVDJZHBOSDHSA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |