C10H11N5O2S — CID 79819985
N-ethyl-5-nitro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine (PubChem CID 79819985) has the molecular formula C10H11N5O2S and a molecular weight of 265.30 g/mol. Its IUPAC name is N-ethyl-5-nitro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-ethyl-5-nitro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 79819985 |
| Molecular Formula | C10H11N5O2S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-ethyl-5-nitro-6-(1,3-thiazol-2-ylmethyl)pyrimidin-4-amine |
| SMILES | CCNc1ncnc(Cc2nccs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N5O2S/c1-2-11-10-9(15(16)17)7(13-6-14-10)5-8-12-3-4-18-8/h3-4,6H,2,5H2,1H3,(H,11,13,14) |
| InChIKey | FXENZJBEJVIFOZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|