C13H16BrN3S — CID 114048222
2-bromo-1-N,5-dimethyl-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,4-diamine (PubChem CID 114048222) has the molecular formula C13H16BrN3S and a molecular weight of 326.26 g/mol. Its IUPAC name is 2-bromo-1-N,5-dimethyl-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,4-diamine.
| Compound Name | 2-bromo-1-N,5-dimethyl-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 114048222 |
| Molecular Formula | C13H16BrN3S |
| Molecular Weight | 326.26 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-bromo-1-N,5-dimethyl-1-N-[(2-methyl-1,3-thiazol-4-yl)methyl]benzene-1,4-diamine |
| SMILES | Cc1nc(CN(C)c2cc(C)c(N)cc2Br)cs1 |
| InChI | InChI=1S/C13H16BrN3S/c1-8-4-13(11(14)5-12(8)15)17(3)6-10-7-18-9(2)16-10/h4-5,7H,6,15H2,1-3H3 |
| InChIKey | WYSDDNADIGNFNT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|