C12H16N4O2S2 — CID 115992574
2-amino-3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenesulfonamide (PubChem CID 115992574) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-amino-3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenesulfonamide.
| Compound Name | 2-amino-3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 115992574 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-amino-3-[methyl-[(2-methyl-1,3-thiazol-4-yl)methyl]amino]benzenesulfonamide |
| SMILES | Cc1nc(CN(C)c2cccc(S(N)(=O)=O)c2N)cs1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-8-15-9(7-19-8)6-16(2)10-4-3-5-11(12(10)13)20(14,17)18/h3-5,7H,6,13H2,1-2H3,(H2,14,17,18) |
| InChIKey | NJVJJMDKQPXYLR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|