C12H12ClN3O2 — CID 114049005
N-(3-chloroquinoxalin-2-yl)-4-hydroxybutanamide (PubChem CID 114049005) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is N-(3-chloroquinoxalin-2-yl)-4-hydroxybutanamide.
| Compound Name | N-(3-chloroquinoxalin-2-yl)-4-hydroxybutanamide |
|---|---|
| PubChem CID | 114049005 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-(3-chloroquinoxalin-2-yl)-4-hydroxybutanamide |
| SMILES | O=C(CCCO)Nc1nc2ccccc2nc1Cl |
| InChI | InChI=1S/C12H12ClN3O2/c13-11-12(16-10(18)6-3-7-17)15-9-5-2-1-4-8(9)14-11/h1-2,4-5,17H,3,6-7H2,(H,15,16,18) |
| InChIKey | CBSMMCZYPVZKOI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |