C10H12Cl2N4O — CID 114049507
(2S)-N-(5,6-dichloropyrimidin-4-yl)piperidine-2-carboxamide (PubChem CID 114049507) has the molecular formula C10H12Cl2N4O and a molecular weight of 275.14 g/mol. Its IUPAC name is (2S)-N-(5,6-dichloropyrimidin-4-yl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(5,6-dichloropyrimidin-4-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114049507 |
| Molecular Formula | C10H12Cl2N4O |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (2S)-N-(5,6-dichloropyrimidin-4-yl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ncnc(Cl)c1Cl)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C10H12Cl2N4O/c11-7-8(12)14-5-15-9(7)16-10(17)6-3-1-2-4-13-6/h5-6,13H,1-4H2,(H,14,15,16,17)/t6-/m0/s1 |
| InChIKey | VOMZQTFWFHHRKD-LURJTMIESA-N |
| XLogP | 1.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |