C10H7Cl3N2O2S2 — CID 114051247
2,5-dichloro-N-(2-chloro-4-methyl-3-pyridinyl)thiophene-3-sulfonamide (PubChem CID 114051247) has the molecular formula C10H7Cl3N2O2S2 and a molecular weight of 357.67 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-chloro-4-methyl-3-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dichloro-N-(2-chloro-4-methyl-3-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 114051247 |
| Molecular Formula | C10H7Cl3N2O2S2 |
| Molecular Weight | 357.67 g/mol |
| Exact Mass | 355.90 |
| IUPAC Name | 2,5-dichloro-N-(2-chloro-4-methyl-3-pyridinyl)thiophene-3-sulfonamide |
| SMILES | Cc1ccnc(Cl)c1NS(=O)(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H7Cl3N2O2S2/c1-5-2-3-14-9(12)8(5)15-19(16,17)6-4-7(11)18-10(6)13/h2-4,15H,1H3 |
| InChIKey | XKSKUGPXSQQVGF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.67 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|