C12H11ClN2O4S2 — CID 65489280
5-[(2-chloro-4-methyl-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 65489280) has the molecular formula C12H11ClN2O4S2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 5-[(2-chloro-4-methyl-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(2-chloro-4-methyl-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 65489280 |
| Molecular Formula | C12H11ClN2O4S2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-[(2-chloro-4-methyl-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2c(C)ccnc2Cl)sc1C(=O)O |
| InChI | InChI=1S/C12H11ClN2O4S2/c1-6-3-4-14-11(13)9(6)15-21(18,19)8-5-7(2)10(20-8)12(16)17/h3-5,15H,1-2H3,(H,16,17) |
| InChIKey | UVROWSTXUIUSFE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|