C10H9N3O4S2 — CID 43616094
3-methyl-5-(pyrazin-2-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 43616094) has the molecular formula C10H9N3O4S2 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-methyl-5-(pyrazin-2-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-(pyrazin-2-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43616094 |
| Molecular Formula | C10H9N3O4S2 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 3-methyl-5-(pyrazin-2-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2cnccn2)sc1C(=O)O |
| InChI | InChI=1S/C10H9N3O4S2/c1-6-4-8(18-9(6)10(14)15)19(16,17)13-7-5-11-2-3-12-7/h2-5H,1H3,(H,12,13)(H,14,15) |
| InChIKey | IEHAVHSOVXXWIV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |