C12H9BrCl2N2S — CID 114051953
5-bromo-2-chloro-N-(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)pyridin-3-amine (PubChem CID 114051953) has the molecular formula C12H9BrCl2N2S and a molecular weight of 364.10 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)pyridin-3-amine.
| Compound Name | 5-bromo-2-chloro-N-(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 114051953 |
| Molecular Formula | C12H9BrCl2N2S |
| Molecular Weight | 364.10 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-chloro-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)pyridin-3-amine |
| SMILES | Clc1cc2c(s1)CCC2Nc1cc(Br)cnc1Cl |
| InChI | InChI=1S/C12H9BrCl2N2S/c13-6-3-9(12(15)16-5-6)17-8-1-2-10-7(8)4-11(14)18-10/h3-5,8,17H,1-2H2 |
| InChIKey | XKBAJQLHIOJPST-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.10 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|