C13H11ClINS — CID 81252050
2-chloro-N-(2-iodophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine (PubChem CID 81252050) has the molecular formula C13H11ClINS and a molecular weight of 375.66 g/mol. Its IUPAC name is 2-chloro-N-(2-iodophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine.
| Compound Name | 2-chloro-N-(2-iodophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
|---|---|
| PubChem CID | 81252050 |
| Molecular Formula | C13H11ClINS |
| Molecular Weight | 375.66 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 2-chloro-N-(2-iodophenyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-4-amine |
| SMILES | Clc1cc2c(s1)CCC2Nc1ccccc1I |
| InChI | InChI=1S/C13H11ClINS/c14-13-7-8-10(5-6-12(8)17-13)16-11-4-2-1-3-9(11)15/h1-4,7,10,16H,5-6H2 |
| InChIKey | FSTUHLQQBPWFML-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|