C11H9F2N3O2 — CID 114053294
4-(3,5-difluorophenoxy)-6-methoxypyrimidin-2-amine (PubChem CID 114053294) has the molecular formula C11H9F2N3O2 and a molecular weight of 253.21 g/mol. Its IUPAC name is 4-(3,5-difluorophenoxy)-6-methoxypyrimidin-2-amine.
| Compound Name | 4-(3,5-difluorophenoxy)-6-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 114053294 |
| Molecular Formula | C11H9F2N3O2 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 4-(3,5-difluorophenoxy)-6-methoxypyrimidin-2-amine |
| SMILES | COc1cc(Oc2cc(F)cc(F)c2)nc(N)n1 |
| InChI | InChI=1S/C11H9F2N3O2/c1-17-9-5-10(16-11(14)15-9)18-8-3-6(12)2-7(13)4-8/h2-5H,1H3,(H2,14,15,16) |
| InChIKey | MIFVNKRXOBQCHO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |