C11H9Cl2N3O — CID 114054154
3,5-dichloro-6-(3-methoxy-2-pyridinyl)pyridin-2-amine (PubChem CID 114054154) has the molecular formula C11H9Cl2N3O and a molecular weight of 270.12 g/mol. Its IUPAC name is 3,5-dichloro-6-(3-methoxy-2-pyridinyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(3-methoxy-2-pyridinyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114054154 |
| Molecular Formula | C11H9Cl2N3O |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | 3,5-dichloro-6-(3-methoxy-2-pyridinyl)pyridin-2-amine |
| SMILES | COc1cccnc1-c1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl2N3O/c1-17-8-3-2-4-15-10(8)9-6(12)5-7(13)11(14)16-9/h2-5H,1H3,(H2,14,16) |
| InChIKey | KCMPALPEAITSAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |