C15H16Cl2N2O2 — CID 102753063
3,5-dichloro-6-(3,4-diethoxyphenyl)pyridin-2-amine (PubChem CID 102753063) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 3,5-dichloro-6-(3,4-diethoxyphenyl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(3,4-diethoxyphenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102753063 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3,5-dichloro-6-(3,4-diethoxyphenyl)pyridin-2-amine |
| SMILES | CCOc1ccc(-c2nc(N)c(Cl)cc2Cl)cc1OCC |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-3-20-12-6-5-9(7-13(12)21-4-2)14-10(16)8-11(17)15(18)19-14/h5-8H,3-4H2,1-2H3,(H2,18,19) |
| InChIKey | VHKMUSREDBTQRF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |