C23H28ClNO4 — CID 138397344
1-(3,4-diethoxyphenyl)-6,7-diethoxyisoquinoline;hydrochloride (PubChem CID 138397344) has the molecular formula C23H28ClNO4 and a molecular weight of 417.93 g/mol. Its IUPAC name is 1-(3,4-diethoxyphenyl)-6,7-diethoxyisoquinoline;hydrochloride.
| Compound Name | 1-(3,4-diethoxyphenyl)-6,7-diethoxyisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 138397344 |
| Molecular Formula | C23H28ClNO4 |
| Molecular Weight | 417.93 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-(3,4-diethoxyphenyl)-6,7-diethoxyisoquinoline;hydrochloride |
| SMILES | CCOc1ccc(-c2nccc3cc(OCC)c(OCC)cc23)cc1OCC.Cl |
| InChI | InChI=1S/C23H27NO4.ClH/c1-5-25-19-10-9-17(14-20(19)26-6-2)23-18-15-22(28-8-4)21(27-7-3)13-16(18)11-12-24-23;/h9-15H,5-8H2,1-4H3;1H |
| InChIKey | XLXNBZYNEIRAJA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.93 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |