C15H16Cl2N2 — CID 102753955
3,5-dichloro-6-[3-(2-methylpropyl)phenyl]pyridin-2-amine (PubChem CID 102753955) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is 3,5-dichloro-6-[3-(2-methylpropyl)phenyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-[3-(2-methylpropyl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102753955 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3,5-dichloro-6-[3-(2-methylpropyl)phenyl]pyridin-2-amine |
| SMILES | CC(C)Cc1cccc(-c2nc(N)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2/c1-9(2)6-10-4-3-5-11(7-10)14-12(16)8-13(17)15(18)19-14/h3-5,7-9H,6H2,1-2H3,(H2,18,19) |
| InChIKey | HTQRMSUVIRVVNN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |