C13H10Cl3N — CID 102752691
2,3,5-trichloro-6-(3-ethylphenyl)pyridine (PubChem CID 102752691) has the molecular formula C13H10Cl3N and a molecular weight of 286.59 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(3-ethylphenyl)pyridine.
| Compound Name | 2,3,5-trichloro-6-(3-ethylphenyl)pyridine |
|---|---|
| PubChem CID | 102752691 |
| Molecular Formula | C13H10Cl3N |
| Molecular Weight | 286.59 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 2,3,5-trichloro-6-(3-ethylphenyl)pyridine |
| SMILES | CCc1cccc(-c2nc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H10Cl3N/c1-2-8-4-3-5-9(6-8)12-10(14)7-11(15)13(16)17-12/h3-7H,2H2,1H3 |
| InChIKey | CKXNCZZDSKFVHK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|