C13H15BrN2OS — CID 114054416
N-[(5-bromothiophen-3-yl)-(3-methoxy-2-pyridinyl)methyl]ethanamine (PubChem CID 114054416) has the molecular formula C13H15BrN2OS and a molecular weight of 327.25 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)-(3-methoxy-2-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-bromothiophen-3-yl)-(3-methoxy-2-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114054416 |
| Molecular Formula | C13H15BrN2OS |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)-(3-methoxy-2-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1csc(Br)c1)c1ncccc1OC |
| InChI | InChI=1S/C13H15BrN2OS/c1-3-15-12(9-7-11(14)18-8-9)13-10(17-2)5-4-6-16-13/h4-8,12,15H,3H2,1-2H3 |
| InChIKey | CYHLRQBIYZOAPR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |