C14H24N2O2 — CID 114055007
2-[2-[(2-methoxyethylamino)methyl]-N,4-dimethylanilino]ethanol (PubChem CID 114055007) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[2-[(2-methoxyethylamino)methyl]-N,4-dimethylanilino]ethanol.
| Compound Name | 2-[2-[(2-methoxyethylamino)methyl]-N,4-dimethylanilino]ethanol |
|---|---|
| PubChem CID | 114055007 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[2-[(2-methoxyethylamino)methyl]-N,4-dimethylanilino]ethanol |
| SMILES | COCCNCc1cc(C)ccc1N(C)CCO |
| InChI | InChI=1S/C14H24N2O2/c1-12-4-5-14(16(2)7-8-17)13(10-12)11-15-6-9-18-3/h4-5,10,15,17H,6-9,11H2,1-3H3 |
| InChIKey | UHPYWDFPYOINCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|