C14H17N3S — CID 114055422
N-[(5-methyl-2-pyrimidin-4-ylsulfanylphenyl)methyl]ethanamine (PubChem CID 114055422) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is N-[(5-methyl-2-pyrimidin-4-ylsulfanylphenyl)methyl]ethanamine.
| Compound Name | N-[(5-methyl-2-pyrimidin-4-ylsulfanylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 114055422 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-[(5-methyl-2-pyrimidin-4-ylsulfanylphenyl)methyl]ethanamine |
| SMILES | CCNCc1cc(C)ccc1Sc1ccncn1 |
| InChI | InChI=1S/C14H17N3S/c1-3-15-9-12-8-11(2)4-5-13(12)18-14-6-7-16-10-17-14/h4-8,10,15H,3,9H2,1-2H3 |
| InChIKey | JKYPZDUWSKLJCR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |