C15H18ClN3S — CID 114864692
N-[(5-chloro-2-pyrimidin-4-ylsulfanylphenyl)methyl]-2-methylpropan-2-amine (PubChem CID 114864692) has the molecular formula C15H18ClN3S and a molecular weight of 307.85 g/mol. Its IUPAC name is N-[(5-chloro-2-pyrimidin-4-ylsulfanylphenyl)methyl]-2-methylpropan-2-amine.
| Compound Name | N-[(5-chloro-2-pyrimidin-4-ylsulfanylphenyl)methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114864692 |
| Molecular Formula | C15H18ClN3S |
| Molecular Weight | 307.85 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-[(5-chloro-2-pyrimidin-4-ylsulfanylphenyl)methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1cc(Cl)ccc1Sc1ccncn1 |
| InChI | InChI=1S/C15H18ClN3S/c1-15(2,3)19-9-11-8-12(16)4-5-13(11)20-14-6-7-17-10-18-14/h4-8,10,19H,9H2,1-3H3 |
| InChIKey | NZWJQMWMVUBRKD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |