C21H25ClN2O — CID 11405627
(Z)-1-(4-chlorophenyl)-N-methoxy-3-(3-phenylpiperidin-1-yl)propan-1-imine (PubChem CID 11405627) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is (Z)-1-(4-chlorophenyl)-N-methoxy-3-(3-phenylpiperidin-1-yl)propan-1-imine.
| Compound Name | (Z)-1-(4-chlorophenyl)-N-methoxy-3-(3-phenylpiperidin-1-yl)propan-1-imine |
|---|---|
| PubChem CID | 11405627 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (Z)-1-(4-chlorophenyl)-N-methoxy-3-(3-phenylpiperidin-1-yl)propan-1-imine |
| SMILES | CO/N=C(/CCN1CCCC(c2ccccc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O/c1-25-23-21(18-9-11-20(22)12-10-18)13-15-24-14-5-8-19(16-24)17-6-3-2-4-7-17/h2-4,6-7,9-12,19H,5,8,13-16H2,1H3/b23-21- |
| InChIKey | NTXUJYMIMWLVIS-LNVKXUELSA-N |
| XLogP | 4.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|