C17H17ClN2 — CID 11842292
5-(4-chlorophenyl)-2-ethyl-4-phenyl-3,4-dihydropyrazole (PubChem CID 11842292) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-ethyl-4-phenyl-3,4-dihydropyrazole.
| Compound Name | 5-(4-chlorophenyl)-2-ethyl-4-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 11842292 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 5-(4-chlorophenyl)-2-ethyl-4-phenyl-3,4-dihydropyrazole |
| SMILES | CCN1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C17H17ClN2/c1-2-20-12-16(13-6-4-3-5-7-13)17(19-20)14-8-10-15(18)11-9-14/h3-11,16H,2,12H2,1H3 |
| InChIKey | MSIQUURSTSWLPX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |