C17H15ClN2O — CID 11842288
1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 11842288) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 11842288 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-4-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1CC(c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C17H15ClN2O/c1-12(21)20-11-16(13-5-3-2-4-6-13)17(19-20)14-7-9-15(18)10-8-14/h2-10,16H,11H2,1H3 |
| InChIKey | PRUOQZRMPIEBLB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |