C13H11Cl2NO2 — CID 114056372
(1S)-1-[2-(2,3-dichlorophenoxy)-3-pyridinyl]ethanol (PubChem CID 114056372) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is (1S)-1-[2-(2,3-dichlorophenoxy)-3-pyridinyl]ethanol.
| Compound Name | (1S)-1-[2-(2,3-dichlorophenoxy)-3-pyridinyl]ethanol |
|---|---|
| PubChem CID | 114056372 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (1S)-1-[2-(2,3-dichlorophenoxy)-3-pyridinyl]ethanol |
| SMILES | C[C@H](O)c1cccnc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H11Cl2NO2/c1-8(17)9-4-3-7-16-13(9)18-11-6-2-5-10(14)12(11)15/h2-8,17H,1H3/t8-/m0/s1 |
| InChIKey | OMEKPGHJRXYQNN-QMMMGPOBSA-N |
| XLogP | 4.23 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |