C11H7Cl2N3OS — CID 55102759
3-(2,3-dichlorophenoxy)pyrazine-2-carbothioamide (PubChem CID 55102759) has the molecular formula C11H7Cl2N3OS and a molecular weight of 300.17 g/mol. Its IUPAC name is 3-(2,3-dichlorophenoxy)pyrazine-2-carbothioamide.
| Compound Name | 3-(2,3-dichlorophenoxy)pyrazine-2-carbothioamide |
|---|---|
| PubChem CID | 55102759 |
| Molecular Formula | C11H7Cl2N3OS |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.97 |
| IUPAC Name | 3-(2,3-dichlorophenoxy)pyrazine-2-carbothioamide |
| SMILES | NC(=S)c1nccnc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H7Cl2N3OS/c12-6-2-1-3-7(8(6)13)17-11-9(10(14)18)15-4-5-16-11/h1-5H,(H2,14,18) |
| InChIKey | XPILGWSTWFIRRV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|