C20H39NO4 — CID 11405648
methyl (3R)-3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-2,2-dimethylundecanoate (PubChem CID 11405648) has the molecular formula C20H39NO4 and a molecular weight of 357.54 g/mol. Its IUPAC name is methyl (3R)-3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-2,2-dimethylundecanoate.
| Compound Name | methyl (3R)-3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-2,2-dimethylundecanoate |
|---|---|
| PubChem CID | 11405648 |
| Molecular Formula | C20H39NO4 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.29 |
| IUPAC Name | methyl (3R)-3-[[(2S)-1-methoxy-3-methyl-1-oxobutan-2-yl]amino]-2,2-dimethylundecanoate |
| SMILES | CCCCCCCC[C@@H](NC(C(=O)OC)C(C)C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C20H39NO4/c1-8-9-10-11-12-13-14-16(20(4,5)19(23)25-7)21-17(15(2)3)18(22)24-6/h15-17,21H,8-14H2,1-7H3/t16-,17?/m1/s1 |
| InChIKey | UKLFSAFWCLRXIH-TZHYSIJRSA-N |
| XLogP | 4.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|