C17H27NO2 — CID 11357898
methyl 3-anilino-2,2-dimethyloctanoate (PubChem CID 11357898) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is methyl 3-anilino-2,2-dimethyloctanoate.
| Compound Name | methyl 3-anilino-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 11357898 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | methyl 3-anilino-2,2-dimethyloctanoate |
| SMILES | CCCCCC(Nc1ccccc1)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C17H27NO2/c1-5-6-8-13-15(17(2,3)16(19)20-4)18-14-11-9-7-10-12-14/h7,9-12,15,18H,5-6,8,13H2,1-4H3 |
| InChIKey | CDRZFKPYWOAOSE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|