C21H23N5O — CID 11405768
N-[(E)-(4-methoxyphenyl)methylideneamino]-5-[4-(2-methylpropyl)phenyl]-1,2,4-triazin-3-amine (PubChem CID 11405768) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is N-[(E)-(4-methoxyphenyl)methylideneamino]-5-[4-(2-methylpropyl)phenyl]-1,2,4-triazin-3-amine.
| Compound Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-5-[4-(2-methylpropyl)phenyl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 11405768 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-[(E)-(4-methoxyphenyl)methylideneamino]-5-[4-(2-methylpropyl)phenyl]-1,2,4-triazin-3-amine |
| SMILES | COc1ccc(/C=N/Nc2nncc(-c3ccc(CC(C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-15(2)12-16-4-8-18(9-5-16)20-14-23-26-21(24-20)25-22-13-17-6-10-19(27-3)11-7-17/h4-11,13-15H,12H2,1-3H3,(H,24,25,26)/b22-13+ |
| InChIKey | PLLZUKFLSIFIQY-LPYMAVHISA-N |
| XLogP | 4.19 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|