C19H15N2O6+ — CID 11405907
4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 11405907) has the molecular formula C19H15N2O6+ and a molecular weight of 367.34 g/mol. Its IUPAC name is 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 11405907 |
| Molecular Formula | C19H15N2O6+ |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2C(=O)/C=C/c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C19H14N2O6/c1-24-14-6-4-13(5-7-14)21-18(19(23)27-20-21)15(22)8-2-12-3-9-16-17(10-12)26-11-25-16/h2-10H,11H2,1H3/p+1/b8-2+ |
| InChIKey | YJRQZGDCPWQHIV-KRXBUXKQSA-O |
| XLogP | 1.88 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|