About 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol
1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol (PubChem CID 114059367) has the molecular formula C11H10BrF2N3O
and a molecular weight of 318.12 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol |
| PubChem CID | 114059367 |
| Molecular Formula | C11H10BrF2N3O |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol |
| SMILES | Cn1nnc(Br)c1C(C)(O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H10BrF2N3O/c1-11(18,9-10(12)15-16-17(9)2)6-4-3-5-7(13)8(6)14/h3-5,18H,1-2H3 |
| InChIKey | QMXHAYBIJDLIQO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol?
The IUPAC name of 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol (CID 114059367) is 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol.
What is the SMILES notation for 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol?
The canonical SMILES for 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol is Cn1nnc(Br)c1C(C)(O)c1cccc(F)c1F.
What is the InChIKey of 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol?
The InChIKey is QMXHAYBIJDLIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrF2N3O/c1-11(18,9-10(12)15-16-17(9)2)6-4-3-5-7(13)8(6)14/h3-5,18H,1-2H3.
What are the key properties of 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol?
1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol has a molecular weight of 318.12 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol is sourced from PubChem (CID 114059367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).