C11H10BrF2N3O — CID 114059367
1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol (PubChem CID 114059367) has the molecular formula C11H10BrF2N3O and a molecular weight of 318.12 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 114059367 |
| Molecular Formula | C11H10BrF2N3O |
| Molecular Weight | 318.12 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-1-(2,3-difluorophenyl)ethanol |
| SMILES | Cn1nnc(Br)c1C(C)(O)c1cccc(F)c1F |
| InChI | InChI=1S/C11H10BrF2N3O/c1-11(18,9-10(12)15-16-17(9)2)6-4-3-5-7(13)8(6)14/h3-5,18H,1-2H3 |
| InChIKey | QMXHAYBIJDLIQO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |