About [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate
[3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate (PubChem CID 11406013) has the molecular formula C17H17ClO7
and a molecular weight of 368.77 g/mol. Its IUPAC name is [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate.
Molecular Properties
| Compound Name | [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate |
| PubChem CID | 11406013 |
| Molecular Formula | C17H17ClO7 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)Oc1cc(OC(=O)CCC(C)=O)cc(C(=O)Cl)c1 |
| InChI | InChI=1S/C17H17ClO7/c1-10(19)3-5-15(21)24-13-7-12(17(18)23)8-14(9-13)25-16(22)6-4-11(2)20/h7-9H,3-6H2,1-2H3 |
| InChIKey | NWBQUDQKACPTSX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate?
The IUPAC name of [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate (CID 11406013) is [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate.
What is the SMILES notation for [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate?
The canonical SMILES for [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate is CC(=O)CCC(=O)Oc1cc(OC(=O)CCC(C)=O)cc(C(=O)Cl)c1.
What is the InChIKey of [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate?
The InChIKey is NWBQUDQKACPTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClO7/c1-10(19)3-5-15(21)24-13-7-12(17(18)23)8-14(9-13)25-16(22)6-4-11(2)20/h7-9H,3-6H2,1-2H3.
What are the key properties of [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate?
[3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate has a molecular weight of 368.77 g/mol, XLogP of 2.61, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-carbonochloridoyl-5-(4-oxopentanoyloxy)phenyl] 4-oxopentanoate is sourced from PubChem (CID 11406013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).