C16H18Cl2O6 — CID 131732095
(3,5-dicarbonochloridoylphenyl) acetate;(E)-hex-3-ene-2,5-diol (PubChem CID 131732095) has the molecular formula C16H18Cl2O6 and a molecular weight of 377.22 g/mol. Its IUPAC name is (3,5-dicarbonochloridoylphenyl) acetate;(E)-hex-3-ene-2,5-diol.
| Compound Name | (3,5-dicarbonochloridoylphenyl) acetate;(E)-hex-3-ene-2,5-diol |
|---|---|
| PubChem CID | 131732095 |
| Molecular Formula | C16H18Cl2O6 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (3,5-dicarbonochloridoylphenyl) acetate;(E)-hex-3-ene-2,5-diol |
| SMILES | CC(=O)Oc1cc(C(=O)Cl)cc(C(=O)Cl)c1.CC(O)/C=C/C(C)O |
| InChI | InChI=1S/C10H6Cl2O4.C6H12O2/c1-5(13)16-8-3-6(9(11)14)2-7(4-8)10(12)15;1-5(7)3-4-6(2)8/h2-4H,1H3;3-8H,1-2H3/b;4-3+ |
| InChIKey | FLEOKSMKKQNMHW-SCBDLNNBSA-N |
| XLogP | 2.67 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|