C14H17BrN2O — CID 114060384
[2-bromo-4-(3,5-diethylpyrazol-1-yl)phenyl]methanol (PubChem CID 114060384) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is [2-bromo-4-(3,5-diethylpyrazol-1-yl)phenyl]methanol.
| Compound Name | [2-bromo-4-(3,5-diethylpyrazol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 114060384 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [2-bromo-4-(3,5-diethylpyrazol-1-yl)phenyl]methanol |
| SMILES | CCc1cc(CC)n(-c2ccc(CO)c(Br)c2)n1 |
| InChI | InChI=1S/C14H17BrN2O/c1-3-11-7-12(4-2)17(16-11)13-6-5-10(9-18)14(15)8-13/h5-8,18H,3-4,9H2,1-2H3 |
| InChIKey | RBQPNJFKEVOCIP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |