C14H16BrN3S — CID 114882799
2-bromo-6-(3,5-diethylpyrazol-1-yl)benzenecarbothioamide (PubChem CID 114882799) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-bromo-6-(3,5-diethylpyrazol-1-yl)benzenecarbothioamide.
| Compound Name | 2-bromo-6-(3,5-diethylpyrazol-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114882799 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-bromo-6-(3,5-diethylpyrazol-1-yl)benzenecarbothioamide |
| SMILES | CCc1cc(CC)n(-c2cccc(Br)c2C(N)=S)n1 |
| InChI | InChI=1S/C14H16BrN3S/c1-3-9-8-10(4-2)18(17-9)12-7-5-6-11(15)13(12)14(16)19/h5-8H,3-4H2,1-2H3,(H2,16,19) |
| InChIKey | GLKMJXBVSWHXDJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|