C14H16ClN3O — CID 82700552
3-chloro-4-(3,5-diethylpyrazol-1-yl)benzamide (PubChem CID 82700552) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 3-chloro-4-(3,5-diethylpyrazol-1-yl)benzamide.
| Compound Name | 3-chloro-4-(3,5-diethylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 82700552 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-chloro-4-(3,5-diethylpyrazol-1-yl)benzamide |
| SMILES | CCc1cc(CC)n(-c2ccc(C(N)=O)cc2Cl)n1 |
| InChI | InChI=1S/C14H16ClN3O/c1-3-10-8-11(4-2)18(17-10)13-6-5-9(14(16)19)7-12(13)15/h5-8H,3-4H2,1-2H3,(H2,16,19) |
| InChIKey | QNOVHAFWXBYDEZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |