C11H9Cl3N2 — CID 66021764
5-chloro-1-(2,4-dichlorophenyl)-3-ethylpyrazole (PubChem CID 66021764) has the molecular formula C11H9Cl3N2 and a molecular weight of 275.57 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dichlorophenyl)-3-ethylpyrazole.
| Compound Name | 5-chloro-1-(2,4-dichlorophenyl)-3-ethylpyrazole |
|---|---|
| PubChem CID | 66021764 |
| Molecular Formula | C11H9Cl3N2 |
| Molecular Weight | 275.57 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 5-chloro-1-(2,4-dichlorophenyl)-3-ethylpyrazole |
| SMILES | CCc1cc(Cl)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C11H9Cl3N2/c1-2-8-6-11(14)16(15-8)10-4-3-7(12)5-9(10)13/h3-6H,2H2,1H3 |
| InChIKey | XKIYOFODNTWOAM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |