C20H19ClN4O3 — CID 46189283
4-chloro-N-[4-(3,5-diethylpyrazol-1-yl)-3-nitrophenyl]benzamide (PubChem CID 46189283) has the molecular formula C20H19ClN4O3 and a molecular weight of 398.85 g/mol. Its IUPAC name is 4-chloro-N-[4-(3,5-diethylpyrazol-1-yl)-3-nitrophenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(3,5-diethylpyrazol-1-yl)-3-nitrophenyl]benzamide |
|---|---|
| PubChem CID | 46189283 |
| Molecular Formula | C20H19ClN4O3 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-chloro-N-[4-(3,5-diethylpyrazol-1-yl)-3-nitrophenyl]benzamide |
| SMILES | CCc1cc(CC)n(-c2ccc(NC(=O)c3ccc(Cl)cc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H19ClN4O3/c1-3-15-11-17(4-2)24(23-15)18-10-9-16(12-19(18)25(27)28)22-20(26)13-5-7-14(21)8-6-13/h5-12H,3-4H2,1-2H3,(H,22,26) |
| InChIKey | KKZCMUIZLCUGTP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|