C13H9BrCl2O2 — CID 114061460
[5-bromo-2-(2,3-dichlorophenoxy)phenyl]methanol (PubChem CID 114061460) has the molecular formula C13H9BrCl2O2 and a molecular weight of 348.02 g/mol. Its IUPAC name is [5-bromo-2-(2,3-dichlorophenoxy)phenyl]methanol.
| Compound Name | [5-bromo-2-(2,3-dichlorophenoxy)phenyl]methanol |
|---|---|
| PubChem CID | 114061460 |
| Molecular Formula | C13H9BrCl2O2 |
| Molecular Weight | 348.02 g/mol |
| Exact Mass | 345.92 |
| IUPAC Name | [5-bromo-2-(2,3-dichlorophenoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)ccc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9BrCl2O2/c14-9-4-5-11(8(6-9)7-17)18-12-3-1-2-10(15)13(12)16/h1-6,17H,7H2 |
| InChIKey | ZECVMURIORFEBJ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.02 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |