C13H9Cl2FO2 — CID 43313342
[2-(2,3-dichlorophenoxy)-5-fluorophenyl]methanol (PubChem CID 43313342) has the molecular formula C13H9Cl2FO2 and a molecular weight of 287.12 g/mol. Its IUPAC name is [2-(2,3-dichlorophenoxy)-5-fluorophenyl]methanol.
| Compound Name | [2-(2,3-dichlorophenoxy)-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 43313342 |
| Molecular Formula | C13H9Cl2FO2 |
| Molecular Weight | 287.12 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | [2-(2,3-dichlorophenoxy)-5-fluorophenyl]methanol |
| SMILES | OCc1cc(F)ccc1Oc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2FO2/c14-10-2-1-3-12(13(10)15)18-11-5-4-9(16)6-8(11)7-17/h1-6,17H,7H2 |
| InChIKey | YSZIFZMONYQVAW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.12 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |