C12H9FIN3O2 — CID 11406147
4-(2-fluoro-4-iodoanilino)-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 11406147) has the molecular formula C12H9FIN3O2 and a molecular weight of 373.13 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11406147 |
| Molecular Formula | C12H9FIN3O2 |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1c[nH]c(=O)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C12H9FIN3O2/c13-8-3-6(14)1-2-9(8)17-10-4-11(18)16-5-7(10)12(15)19/h1-5H,(H2,15,19)(H2,16,17,18) |
| InChIKey | HALXYXINRHRFCA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|