C15H19Br2N — CID 114061595
4-bromo-2-(bromomethyl)-N,N-bis(cyclopropylmethyl)aniline (PubChem CID 114061595) has the molecular formula C15H19Br2N and a molecular weight of 373.13 g/mol. Its IUPAC name is 4-bromo-2-(bromomethyl)-N,N-bis(cyclopropylmethyl)aniline.
| Compound Name | 4-bromo-2-(bromomethyl)-N,N-bis(cyclopropylmethyl)aniline |
|---|---|
| PubChem CID | 114061595 |
| Molecular Formula | C15H19Br2N |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 4-bromo-2-(bromomethyl)-N,N-bis(cyclopropylmethyl)aniline |
| SMILES | BrCc1cc(Br)ccc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C15H19Br2N/c16-8-13-7-14(17)5-6-15(13)18(9-11-1-2-11)10-12-3-4-12/h5-7,11-12H,1-4,8-10H2 |
| InChIKey | ZISCMNFYQDHYSS-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|