C14H17BrClN — CID 107084049
2-(bromomethyl)-4-chloro-N-cyclopropyl-N-(cyclopropylmethyl)aniline (PubChem CID 107084049) has the molecular formula C14H17BrClN and a molecular weight of 314.65 g/mol. Its IUPAC name is 2-(bromomethyl)-4-chloro-N-cyclopropyl-N-(cyclopropylmethyl)aniline.
| Compound Name | 2-(bromomethyl)-4-chloro-N-cyclopropyl-N-(cyclopropylmethyl)aniline |
|---|---|
| PubChem CID | 107084049 |
| Molecular Formula | C14H17BrClN |
| Molecular Weight | 314.65 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 2-(bromomethyl)-4-chloro-N-cyclopropyl-N-(cyclopropylmethyl)aniline |
| SMILES | Clc1ccc(N(CC2CC2)C2CC2)c(CBr)c1 |
| InChI | InChI=1S/C14H17BrClN/c15-8-11-7-12(16)3-6-14(11)17(13-4-5-13)9-10-1-2-10/h3,6-7,10,13H,1-2,4-5,8-9H2 |
| InChIKey | DWXQYFAIWCJNBM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|