C17H25FN2 — CID 64520411
N-cyclopropyl-N-(cyclopropylmethyl)-2-fluoro-4-[(propan-2-ylamino)methyl]aniline (PubChem CID 64520411) has the molecular formula C17H25FN2 and a molecular weight of 276.40 g/mol. Its IUPAC name is N-cyclopropyl-N-(cyclopropylmethyl)-2-fluoro-4-[(propan-2-ylamino)methyl]aniline.
| Compound Name | N-cyclopropyl-N-(cyclopropylmethyl)-2-fluoro-4-[(propan-2-ylamino)methyl]aniline |
|---|---|
| PubChem CID | 64520411 |
| Molecular Formula | C17H25FN2 |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N-cyclopropyl-N-(cyclopropylmethyl)-2-fluoro-4-[(propan-2-ylamino)methyl]aniline |
| SMILES | CC(C)NCc1ccc(N(CC2CC2)C2CC2)c(F)c1 |
| InChI | InChI=1S/C17H25FN2/c1-12(2)19-10-14-5-8-17(16(18)9-14)20(15-6-7-15)11-13-3-4-13/h5,8-9,12-13,15,19H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | YNWLQJQNHWCVHK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|