C13H18BrNO2 — CID 114062339
[3-bromo-4-[cyclopropyl(2-methoxyethyl)amino]phenyl]methanol (PubChem CID 114062339) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is [3-bromo-4-[cyclopropyl(2-methoxyethyl)amino]phenyl]methanol.
| Compound Name | [3-bromo-4-[cyclopropyl(2-methoxyethyl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 114062339 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | [3-bromo-4-[cyclopropyl(2-methoxyethyl)amino]phenyl]methanol |
| SMILES | COCCN(c1ccc(CO)cc1Br)C1CC1 |
| InChI | InChI=1S/C13H18BrNO2/c1-17-7-6-15(11-3-4-11)13-5-2-10(9-16)8-12(13)14/h2,5,8,11,16H,3-4,6-7,9H2,1H3 |
| InChIKey | AGALHOKMLSDHAX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|