C14H21BrN2 — CID 114062692
2-bromo-N-cyclopropyl-N-ethyl-4-(ethylaminomethyl)aniline (PubChem CID 114062692) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-bromo-N-cyclopropyl-N-ethyl-4-(ethylaminomethyl)aniline.
| Compound Name | 2-bromo-N-cyclopropyl-N-ethyl-4-(ethylaminomethyl)aniline |
|---|---|
| PubChem CID | 114062692 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-bromo-N-cyclopropyl-N-ethyl-4-(ethylaminomethyl)aniline |
| SMILES | CCNCc1ccc(N(CC)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C14H21BrN2/c1-3-16-10-11-5-8-14(13(15)9-11)17(4-2)12-6-7-12/h5,8-9,12,16H,3-4,6-7,10H2,1-2H3 |
| InChIKey | IRWTXWZMKHMJKS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|