C17H21ClN2S — CID 81147081
2-chloro-N-cyclopropyl-4-(ethylaminomethyl)-N-(thiophen-3-ylmethyl)aniline (PubChem CID 81147081) has the molecular formula C17H21ClN2S and a molecular weight of 320.89 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-4-(ethylaminomethyl)-N-(thiophen-3-ylmethyl)aniline.
| Compound Name | 2-chloro-N-cyclopropyl-4-(ethylaminomethyl)-N-(thiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 81147081 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-chloro-N-cyclopropyl-4-(ethylaminomethyl)-N-(thiophen-3-ylmethyl)aniline |
| SMILES | CCNCc1ccc(N(Cc2ccsc2)C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C17H21ClN2S/c1-2-19-10-13-3-6-17(16(18)9-13)20(15-4-5-15)11-14-7-8-21-12-14/h3,6-9,12,15,19H,2,4-5,10-11H2,1H3 |
| InChIKey | KSMBFPCCOLWEKS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|