C14H17ClN2S — CID 81148615
2-chloro-N-methyl-4-(methylaminomethyl)-N-(thiophen-3-ylmethyl)aniline (PubChem CID 81148615) has the molecular formula C14H17ClN2S and a molecular weight of 280.82 g/mol. Its IUPAC name is 2-chloro-N-methyl-4-(methylaminomethyl)-N-(thiophen-3-ylmethyl)aniline.
| Compound Name | 2-chloro-N-methyl-4-(methylaminomethyl)-N-(thiophen-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 81148615 |
| Molecular Formula | C14H17ClN2S |
| Molecular Weight | 280.82 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-chloro-N-methyl-4-(methylaminomethyl)-N-(thiophen-3-ylmethyl)aniline |
| SMILES | CNCc1ccc(N(C)Cc2ccsc2)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClN2S/c1-16-8-11-3-4-14(13(15)7-11)17(2)9-12-5-6-18-10-12/h3-7,10,16H,8-9H2,1-2H3 |
| InChIKey | HRFPHOVXHDSFOF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|