About 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid
1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid (PubChem CID 11406237) has the molecular formula C19H15F3N2O3
and a molecular weight of 376.33 g/mol. Its IUPAC name is 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid |
| PubChem CID | 11406237 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)nn1Cc1cc(F)ccc1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C19H15F3N2O3/c1-11-6-17(19(25)26)23-24(11)9-13-7-14(20)4-5-18(13)27-10-12-2-3-15(21)8-16(12)22/h2-8H,9-10H2,1H3,(H,25,26) |
| InChIKey | APPPPSTYYVIZQT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid?
The IUPAC name of 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid (CID 11406237) is 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid.
What is the SMILES notation for 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid?
The canonical SMILES for 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid is Cc1cc(C(=O)O)nn1Cc1cc(F)ccc1OCc1ccc(F)cc1F.
What is the InChIKey of 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid?
The InChIKey is APPPPSTYYVIZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O3/c1-11-6-17(19(25)26)23-24(11)9-13-7-14(20)4-5-18(13)27-10-12-2-3-15(21)8-16(12)22/h2-8H,9-10H2,1H3,(H,25,26).
What are the key properties of 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid?
1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid has a molecular weight of 376.33 g/mol, XLogP of 3.93, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-[(2,4-difluorophenyl)methoxy]-5-fluorophenyl]methyl]-5-methylpyrazole-3-carboxylic acid is sourced from PubChem (CID 11406237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).